(3E)-3-{[1-(4-Ethoxyphenyl)propan-2-yl]imino}butan-2-one
 2770 C15H21NO2 247.333
 InChI=1S/C15H21NO2/c1-5-18-15-8-6-14(7-9-15)10-11(2)16-12(3)13(4)17/h6-9,11H,5,10H2,1-4H3/b16-12+
 BIVKXPPJUMECCI-FOWTUZBSSA-N This stereoisomer Any stereoisomer
 CCOc1ccc(cc1)CC(/N=C(/C(=O)C)\C)C