N-[1-(4-Propoxyphenyl)propan-2-yl]acetamide
 2766 C14H21NO2 235.322
 InChI=1S/C14H21NO2/c1-4-9-17-14-7-5-13(6-8-14)10-11(2)15-12(3)16/h5-8,11H,4,9-10H2,1-3H3,(H,15,16)
 MYUXQSUDNFVRPL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCOc1ccc(cc1)CC(NC(=O)C)C