N-[1-(4-Ethoxyphenyl)propan-2-yl]acetamide
 2765 C13H19NO2 221.295
 InChI=1S/C13H19NO2/c1-4-16-13-7-5-12(6-8-13)9-10(2)14-11(3)15/h5-8,10H,4,9H2,1-3H3,(H,14,15)
 SEYZMKOZZQPIKU-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCOc1ccc(cc1)CC(NC(=O)C)C