7-Chloro-2,3,4,5-tetrahydro-1H-3-benzazepine
 2753 C10H12ClN 181.662
 InChI=1S/C10H12ClN/c11-10-2-1-8-3-5-12-6-4-9(8)7-10/h1-2,7,12H,3-6H2
 ZJIUEDYXZUIMNV-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 Clc1ccc2c(c1)CCNCC2