7-Methoxy-1-methyl-2,3,4,5-tetrahydro-1H-3-benzazepine
 2729 C12H17NO 191.269
 InChI=1S/C12H17NO/c1-9-8-13-6-5-10-7-11(14-2)3-4-12(9)10/h3-4,7,9,13H,5-6,8H2,1-2H3
 AMIACDDVTGCQRL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccc2c(c1)CCNCC2C