Viloxazine
2-[(2-Ethoxyphenoxy)methyl]morpholine
 2696 C13H19NO3 237.295
 InChI=1S/C13H19NO3/c1-2-15-12-5-3-4-6-13(12)17-10-11-9-14-7-8-16-11/h3-6,11,14H,2,7-10H2,1H3
 YWPHCCPCQOJSGZ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCOc1ccccc1OCC1CNCCO1