4-Methylephedrine
2-(Methylamino)-1-(4-methylphenyl)propan-1-ol
 2668 C11H17NO 179.259
 InChI=1S/C11H17NO/c1-8-4-6-10(7-5-8)11(13)9(2)12-3/h4-7,9,11-13H,1-3H3
 DUESQFQLBNOCIT-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC(C(c1ccc(cc1)C)O)C