2-FAB
1-(2-Fluorophenyl)butan-2-amine
 2660  C10H14FN  167.223
 InChI=1S/C10H14FN/c1-2-9(12)7-8-5-3-4-6-10(8)11/h3-6,9H,2,7,12H2,1H3
 JCTBCXCLKYQKLR-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCC(Cc1ccccc1F)N