ALOMA
1-{3-Methoxy-4-[(prop-2-en-1-yl)oxy]phenyl}propan-2-amine
 2658 C13H19NO2 221.295
 InChI=1S/C13H19NO2/c1-4-7-16-12-6-5-11(8-10(2)14)9-13(12)15-3/h4-6,9-10H,1,7-8,14H2,2-3H3
 OGCZLBLLQMDGDT-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 C=CCOc1ccc(cc1OC)CC(N)C