Homomethamphetamine
N-Methyl-4-phenylbutan-2-amine
 2654 C11H17N 163.259
 InChI=1S/C11H17N/c1-10(12-2)8-9-11-6-4-3-5-7-11/h3-7,10,12H,8-9H2,1-2H3
 PUAUJIPHHQUZGF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC(CCc1ccccc1)C