2-MPEA-NBOMe
2-(2-Methoxyphenyl)-N-[(2-methoxyphenyl)methyl]ethan-1-amine
 2646  C17H21NO2  271.354
 InChI=1S/C17H21NO2/c1-19-16-9-5-3-7-14(16)11-12-18-13-15-8-4-6-10-17(15)20-2/h3-10,18H,11-13H2,1-2H3
 FSYRKJVGKRXEHZ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccccc1CNCCc1ccccc1OC