2-DM-25B-NBOMe
5-Bromo-4-methoxy-2-(2-{[(2-methoxyphenyl)methyl]amino}ethyl)phenol
 2618  C17H20BrNO3  366.25
 InChI=1S/C17H20BrNO3/c1-21-16-6-4-3-5-13(16)11-19-8-7-12-9-17(22-2)14(18)10-15(12)20/h3-6,9-10,19-20H,7-8,11H2,1-2H3
 YQTBFLQYLRNAPK-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(CCNCc2ccccc2OC)c(cc1Br)O