5-BnO-DIPT
N-{2-[4-(Benzyloxy)-1H-indol-3-yl]ethyl}-N-(propan-2-yl)propan-2-amine
 2609  C23H30N2O  350.497
 InChI=1S/C23H30N2O/c1-17(2)25(18(3)4)14-13-20-15-24-21-11-8-12-22(23(20)21)26-16-19-9-6-5-7-10-19/h5-12,15,17-18,24H,13-14,16H2,1-4H3
 MKPXTQZJLOLUEN-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(N(C(C)C)CCc1c[nH]c2c1c(ccc2)OCc1ccccc1)C