4-BnO-DMT
2-[4-(Benzyloxy)-1H-indol-3-yl]-N,N-dimethylethan-1-amine
 2607  C19H22N2O  294.391
 InChI=1S/C19H22N2O/c1-21(2)12-11-16-13-20-17-9-6-10-18(19(16)17)22-14-15-7-4-3-5-8-15/h3-10,13,20H,11-12,14H2,1-2H3
 LHERKDDDEMCCCU-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(CCc1c[nH]c2c1c(ccc2)OCc1ccccc1)C