Isopentedrone
1-(Methylamino)-1-phenylpentan-2-one
 2527  C12H17NO  191.269
 InChI=1S/C12H17NO/c1-3-7-11(14)12(13-2)10-8-5-4-6-9-10/h4-6,8-9,12-13H,3,7H2,1-2H3
 ILGRTMNCRBDXBI-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCC(=O)C(c1ccccc1)NC