5-PhEtO-2-MPEA
2-[2-Methoxy-5-(2-phenylethoxy)phenyl]ethan-1-amine
 2496  C17H21NO2  271.354
 InChI=1S/C17H21NO2/c1-19-17-8-7-16(13-15(17)9-11-18)20-12-10-14-5-3-2-4-6-14/h2-8,13H,9-12,18H2,1H3
 XZYBODNZTGTBIN-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OCCc2ccccc2)ccc1OC