4-PhPey-2-MPEA
2-[2-Methoxy-4-(5-phenylpent-1-yn-1-yl)phenyl]ethan-1-amine
 2491 C20H23NO 293.403
 InChI=1S/C20H23NO/c1-22-20-16-18(12-13-19(20)14-15-21)11-7-3-6-10-17-8-4-2-5-9-17/h2,4-5,8-9,12-13,16H,3,6,10,14-15,21H2,1H3
 NNSCYTVKHDKQOO-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1ccc(cc1OC)C#CCCCc1ccccc1