4-PhPe-2-MPEA
2-[2-Methoxy-4-(5-phenylpentyl)phenyl]ethan-1-amine
 2488 C20H27NO 297.434
 InChI=1S/C20H27NO/c1-22-20-16-18(12-13-19(20)14-15-21)11-7-3-6-10-17-8-4-2-5-9-17/h2,4-5,8-9,12-13,16H,3,6-7,10-11,14-15,21H2,1H3
 AAJRSNRXMUUFIO-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1ccc(cc1OC)CCCCCc1ccccc1