4-PhBu-2-MPEA
2-[2-Methoxy-4-(4-phenylbutyl)phenyl]ethan-1-amine
 2487 C19H25NO 283.408
 InChI=1S/C19H25NO/c1-21-19-15-17(11-12-18(19)13-14-20)10-6-5-9-16-7-3-2-4-8-16/h2-4,7-8,11-12,15H,5-6,9-10,13-14,20H2,1H3
 OPIZIKOWMQZFRG-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1ccc(cc1OC)CCCCc1ccccc1