Pentedrone
2-(Methylamino)-1-phenylpentan-1-one
 2434  C12H17NO  191.269
 InChI=1S/C12H17NO/c1-3-7-11(13-2)12(14)10-8-5-4-6-9-10/h4-6,8-9,11,13H,3,7H2,1-2H3
 WLIWIUNEJRETFX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCC(C(=O)c1ccccc1)NC