N-Bu-ADTN
6-(Butylamino)-5,6,7,8-tetrahydronaphthalene-2,3-diol
 2423 C14H21NO2 235.322
 InChI=1S/C14H21NO2/c1-2-3-6-15-12-5-4-10-8-13(16)14(17)9-11(10)7-12/h8-9,12,15-17H,2-7H2,1H3
 FLQPTCDCGBQBMR-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCNC1CCc2c(C1)cc(c(c2)O)O