4-Isobutoxycathinone
2-Amino-1-[4-(2-methylpropoxy)phenyl]propan-1-one
 2386 C13H19NO2 221.295
 InChI=1S/C13H19NO2/c1-9(2)8-16-12-6-4-11(5-7-12)13(15)10(3)14/h4-7,9-10H,8,14H2,1-3H3
 STOYCZYFRRFXRX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(COc1ccc(cc1)C(=O)C(N)C)C