4-Butoxycathinone
2-Amino-1-(4-butoxyphenyl)propan-1-one
 2385 C13H19NO2 221.295
 InChI=1S/C13H19NO2/c1-3-4-9-16-12-7-5-11(6-8-12)13(15)10(2)14/h5-8,10H,3-4,9,14H2,1-2H3
 SASXJIXGUNKEAQ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCOc1ccc(cc1)C(=O)C(N)C