N-Acetyl-3,4-dimethoxyphenethylamine
N-[2-(3,4-Dimethoxyphenyl)ethyl]acetamide
 233  C12H17NO3  223.268
 InChI=1S/C12H17NO3/c1-9(14)13-7-6-10-4-5-11(15-2)12(8-10)16-3/h4-5,8H,6-7H2,1-3H3,(H,13,14)
 WEQRLEDPPGQGOP-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(CCNC(=O)C)ccc1OC