5,8-Dimethoxy-2,7-dimethyl-1,2,3,4-tetrahydroisoquinoline
 2281 C13H19NO2 221.295
 InChI=1S/C13H19NO2/c1-9-7-12(15-3)10-5-6-14(2)8-11(10)13(9)16-4/h7H,5-6,8H2,1-4H3
 AEBCKWSKCYYSQL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(C)c(c2c1CCN(C2)C)OC