DMMH-2
6,7-Dimethoxy-1-methyl-3,4-dihydroisoquinoline
 2278  C12H15NO2  205.253
 InChI=1S/C12H15NO2/c1-8-10-7-12(15-3)11(14-2)6-9(10)4-5-13-8/h6-7H,4-5H2,1-3H3
 VASUQTGZAPZKFK-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc2C(=NCCc2cc1OC)C