Salsoline
7-Methoxy-1,2,3,4-tetrahydroisoquinolin-6-ol
 2268  C10H13NO2  179.216
 InChI=1S/C10H13NO2/c1-13-10-5-8-6-11-3-2-7(8)4-9(10)12/h4-5,11-12H,2-3,6H2,1H3
 MHTLPFVHBVOGMZ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc2CNCCc2cc1O