2C-EF-FLY
2-[8-(2-Fluoroethyl)-2,3,6,7-tetrahydrobenzo[1,2-b:4,5-b′]difuran-4-yl]ethan-1-amine
 2066 C14H18FNO2 251.297
 InChI=1S/C14H18FNO2/c15-5-1-9-11-3-7-18-14(11)10(2-6-16)12-4-8-17-13(9)12/h1-8,16H2
 NUNWOBYVOQRPKC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1c2CCOc2c(c2c1OCC2)CCF