4-Methoxy-2,3-(trimethylene)amphetamine
1-(7-Methoxy-2,3-dihydro-1H-inden-4-yl)propan-2-amine
 2061 C13H19NO 205.296
 InChI=1S/C13H19NO/c1-9(14)8-10-6-7-13(15-2)12-5-3-4-11(10)12/h6-7,9H,3-5,8,14H2,1-2H3
 VYHNIRHNIUKAGD-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccc(c2c1CCC2)CC(N)C