5-MeO-NIPBCT
3-(5-Methoxy-1H-indol-3-yl)-N-(propan-2-yl)bicyclo[2.2.1]heptan-2-amine
 1986  C19H26N2O  298.423
 InChI=1S/C19H26N2O/c1-11(2)21-19-13-5-4-12(8-13)18(19)16-10-20-17-7-6-14(22-3)9-15(16)17/h6-7,9-13,18-21H,4-5,8H2,1-3H3
 SOUDCBWHVBZNTA-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccc2c(c1)c(c[nH]2)C1C2CCC(C1NC(C)C)C2