N-Acetyl 2C-B
N-[2-(4-Bromo-2,5-dimethoxyphenyl)ethyl]acetamide
 1923  C12H16BrNO3  302.164
 InChI=1S/C12H16BrNO3/c1-8(15)14-5-4-9-6-12(17-3)10(13)7-11(9)16-2/h6-7H,4-5H2,1-3H3,(H,14,15)
 FPJLSDPZIUNKGU-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(Br)c(cc1CCNC(=O)C)OC