2-(2-Chlorophenyl)-2-(methylamino)cycloheptan-1-one
 1908 C14H18ClNO 251.752
 Arylcycloalkylamine
 InChI=1S/C14H18ClNO/c1-16-14(10-6-2-3-9-13(14)17)11-7-4-5-8-12(11)15/h4-5,7-8,16H,2-3,6,9-10H2,1H3
 FKCRBVNGXRDKDF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC1(CCCCCC1=O)c1ccccc1Cl