5-HO-4-Me-2-MBAL
5-Hydroxy-2-methoxy-4-methylbenzaldehyde
 1856  C9H10O3  166.174
 InChI=1S/C9H10O3/c1-6-3-9(12-2)7(5-10)4-8(6)11/h3-5,11H,1-2H3
 PXHCOQXCRPEFEE-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(C)c(cc1C=O)O