N-Methyl-N-propyl-1,2,3,4-tetrahydronaphthalen-2-amine
 1827 C14H21N 203.323
 InChI=1S/C14H21N/c1-3-10-15(2)14-9-8-12-6-4-5-7-13(12)11-14/h4-7,14H,3,8-11H2,1-2H3
 IKBLUXKMPBAJPP-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCN(C1CCc2c(C1)cccc2)C