N,N-Diethyl-2-methyl-1,2,3,4-tetrahydroisoquinoline-4-carboxamide
 1822 C15H22N2O 246.348
 InChI=1S/C15H22N2O/c1-4-17(5-2)15(18)14-11-16(3)10-12-8-6-7-9-13(12)14/h6-9,14H,4-5,10-11H2,1-3H3
 HAPCGTWEXKQNKC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCN(C(=O)C1CN(C)Cc2c1cccc2)CC