1-({[2-(4-Ethyl-2,5-dimethoxyphenyl)ethyl]amino}oxy)ethan-1-one
 1762  C14H21NO4  267.321
 InChI=1S/C14H21NO4/c1-5-11-8-14(18-4)12(9-13(11)17-3)6-7-15-19-10(2)16/h8-9,15H,5-7H2,1-4H3
 CKOJKTZYRAKJDY-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(CC)c(cc1CCNOC(=O)C)OC