(2-Adamantyl) 5Cl-APINACA
N-(Adamantan-2-yl)-1-(5-chloropentyl)-1H-indazole-3-carboxamide
 1752 C23H30ClN3O 399.957
 Cannabinoid
 InChI=1S/C23H30ClN3O/c24-8-4-1-5-9-27-20-7-3-2-6-19(20)22(26-27)23(28)25-21-17-11-15-10-16(13-17)14-18(21)12-15/h2-3,6-7,15-18,21H,1,4-5,8-14H2,(H,25,28)
 BQXKZFLRAMAHCG-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 ClCCCCCn1nc(c2c1cccc2)C(=O)NC1C2CC3CC1CC(C2)C3