α-Methyl-isobutyrylfentanyl
2-Methyl-N-phenyl-N-[1-(1-phenylpropan-2-yl)piperidin-4-yl]propanamide
 1680 C24H32N2O 364.524
 Fentanyl
 InChI=1S/C24H32N2O/c1-19(2)24(27)26(22-12-8-5-9-13-22)23-14-16-25(17-15-23)20(3)18-21-10-6-4-7-11-21/h4-13,19-20,23H,14-18H2,1-3H3
 UAMAVNLZTHVLCE-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(N1CCC(CC1)N(C(=O)C(C)C)c1ccccc1)Cc1ccccc1