Thiophenoylfentanyl
N-Phenyl-N-[1-(2-phenylethyl)piperidin-4-yl]thiophene-2-carboxamide
 1644  C24H26N2OS  390.541
 Fentanyl
 InChI=1S/C24H26N2OS/c27-24(23-12-7-19-28-23)26(21-10-5-2-6-11-21)22-14-17-25(18-15-22)16-13-20-8-3-1-4-9-20/h1-12,19,22H,13-18H2
 CCHPKGYUIHSQIE-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 O=C(N(c1ccccc1)C1CCN(CC1)CCc1ccccc1)c1cccs1