4-Methylfentanyl
N-[4-Methyl-1-(2-phenylethyl)piperidin-4-yl]-N-phenylpropanamide
 1603 C23H30N2O 350.497
 Fentanyl
 InChI=1S/C23H30N2O/c1-3-22(26)25(21-12-8-5-9-13-21)23(2)15-18-24(19-16-23)17-14-20-10-6-4-7-11-20/h4-13H,3,14-19H2,1-2H3
 GNKKPEHVTFKLMN-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCC(=O)N(C1(C)CCN(CC1)CCc1ccccc1)c1ccccc1