N-Me-4-Cl-PEA
2-(4-Chlorophenyl)-N-methylethan-1-amine
 1573  C9H12ClN  169.651
 InChI=1S/C9H12ClN/c1-11-7-6-8-2-4-9(10)5-3-8/h2-5,11H,6-7H2,1H3
 VCSUCPDSYSXLEX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNCCc1ccc(cc1)Cl