N-Me-2-Cl-PEA
2-(2-Chlorophenyl)-N-methylethan-1-amine
 1569  C9H12ClN  169.651
 InChI=1S/C9H12ClN/c1-11-7-6-8-4-2-3-5-9(8)10/h2-5,11H,6-7H2,1H3
 DTJKAALGEAHUIV-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNCCc1ccccc1Cl