N,N-Me-4-F-PEA
2-(4-Fluorophenyl)-N,N-dimethylethan-1-amine
 1568  C10H14FN  167.223
 InChI=1S/C10H14FN/c1-12(2)8-7-9-3-5-10(11)6-4-9/h3-6H,7-8H2,1-2H3
 JADXOJJQSYBMLW-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(CCc1ccc(cc1)F)C