N,N-Me-3-F-PEA
2-(3-Fluorophenyl)-N,N-dimethylethan-1-amine
 1566  C10H14FN  167.223
 InChI=1S/C10H14FN/c1-12(2)7-6-9-4-3-5-10(11)8-9/h3-5,8H,6-7H2,1-2H3
 ZXRFTQNOESGYCM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(CCc1cccc(c1)F)C