β-iPr-PEA
3-Methyl-2-phenylbutan-1-amine
 1561 C11H17N 163.259
 InChI=1S/C11H17N/c1-9(2)11(8-12)10-6-4-3-5-7-10/h3-7,9,11H,8,12H2,1-2H3
 VDMAQVANUGNDOM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCC(c1ccccc1)C(C)C