4-IAI
4-Iodo-2,3-dihydro-1H-inden-2-amine
 1552  C9H10IN  259.087
 InChI=1S/C9H10IN/c10-9-3-1-2-6-4-7(11)5-8(6)9/h1-3,7H,4-5,11H2
 RBWLCTDWGYEJIG-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NC1Cc2c(C1)cccc2I