C-POMA
1-(2-Chloro-5-methoxy-4-propoxyphenyl)propan-2-amine
 1503 C13H20ClNO2 257.756
 InChI=1S/C13H20ClNO2/c1-4-5-17-13-8-11(14)10(6-9(2)15)7-12(13)16-3/h7-9H,4-6,15H2,1-3H3
 UODNFQMHPOYTCL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCOc1cc(Cl)c(cc1OC)CC(N)C