BZOMA
1-[4-(Benzyloxy)-3-methoxyphenyl]propan-2-amine
 1501 C17H21NO2 271.354
 InChI=1S/C17H21NO2/c1-13(18)10-15-8-9-16(17(11-15)19-2)20-12-14-6-4-3-5-7-14/h3-9,11,13H,10,12,18H2,1-2H3
 JISYSNUFDJQBKV-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(ccc1OCc1ccccc1)CC(N)C