2,5-HO-4-CNPEA
4-(2-Aminoethyl)-2,5-dihydroxybenzonitrile
 1459  C9H10N2O2  178.188
 InChI=1S/C9H10N2O2/c10-2-1-6-3-9(13)7(5-11)4-8(6)12/h3-4,12-13H,1-2,10H2
 FDUICKXFJBJSNA-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(O)c(cc1O)C#N