2,5-HO-PEA
2-(2-Aminoethyl)benzene-1,4-diol
 1455  C8H11NO2  153.178
 InChI=1S/C8H11NO2/c9-4-3-6-5-7(10)1-2-8(6)11/h1-2,5,10-11H,3-4,9H2
 XYMGUIWNLBMCIF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(O)ccc1O